C18H27N2O3+ — CID 8583610
2-(azocan-1-ium-1-yl)-N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide (PubChem CID 8583610) has the molecular formula C18H27N2O3+ and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(azocan-1-ium-1-yl)-N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide.
| Compound Name | 2-(azocan-1-ium-1-yl)-N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 8583610 |
| Molecular Formula | C18H27N2O3+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-(azocan-1-ium-1-yl)-N-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)C[NH+]1CCCCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H26N2O3/c1-14(15-7-8-16-17(11-15)23-13-22-16)19-18(21)12-20-9-5-3-2-4-6-10-20/h7-8,11,14H,2-6,9-10,12-13H2,1H3,(H,19,21)/p+1/t14-/m1/s1 |
| InChIKey | OQXXGPNFIJJKQK-CQSZACIVSA-O |
| XLogP | 1.44 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |