About N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide (PubChem CID 60648461) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide.
Molecular Properties
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide |
| PubChem CID | 60648461 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide |
| SMILES | CCCNCC(=O)NC(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-3-6-15-8-14(17)16-10(2)11-4-5-12-13(7-11)19-9-18-12/h4-5,7,10,15H,3,6,8-9H2,1-2H3,(H,16,17) |
| InChIKey | LYVKWRZMQVTRAI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide?
The IUPAC name of N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide (CID 60648461) is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide.
What is the SMILES notation for N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide?
The canonical SMILES for N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide is CCCNCC(=O)NC(C)c1ccc2c(c1)OCO2.
What is the InChIKey of N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide?
The InChIKey is LYVKWRZMQVTRAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-3-6-15-8-14(17)16-10(2)11-4-5-12-13(7-11)19-9-18-12/h4-5,7,10,15H,3,6,8-9H2,1-2H3,(H,16,17).
What are the key properties of N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide?
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide has a molecular weight of 264.32 g/mol, XLogP of 1.59, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(propylamino)acetamide is sourced from PubChem (CID 60648461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).