C14H20N2O3 — CID 27459871
1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-butylurea (PubChem CID 27459871) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-butylurea.
| Compound Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-butylurea |
|---|---|
| PubChem CID | 27459871 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-butylurea |
| SMILES | CCCCNC(=O)N[C@@H](C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-3-4-7-15-14(17)16-10(2)11-5-6-12-13(8-11)19-9-18-12/h5-6,8,10H,3-4,7,9H2,1-2H3,(H2,15,16,17)/t10-/m0/s1 |
| InChIKey | CAZLYHKCPQPPHH-JTQLQIEISA-N |
| XLogP | 2.58 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|