C14H20N2O3 — CID 29024804
1-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-propylurea (PubChem CID 29024804) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-propylurea.
| Compound Name | 1-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-propylurea |
|---|---|
| PubChem CID | 29024804 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-propylurea |
| SMILES | CCCNC(=O)N[C@@H](C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-3-6-15-14(17)16-10(2)11-4-5-12-13(9-11)19-8-7-18-12/h4-5,9-10H,3,6-8H2,1-2H3,(H2,15,16,17)/t10-/m0/s1 |
| InChIKey | HNWUGKJCJZZOSN-JTQLQIEISA-N |
| XLogP | 2.23 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |