C25H30N3O+ — CID 8725806
2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 8725806) has the molecular formula C25H30N3O+ and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 8725806 |
| Molecular Formula | C25H30N3O+ |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | Cc1ccccc1N1CC[NH+](CC(=O)N[C@H](C)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C25H29N3O/c1-19-7-3-6-10-24(19)28-15-13-27(14-16-28)18-25(29)26-20(2)22-12-11-21-8-4-5-9-23(21)17-22/h3-12,17,20H,13-16,18H2,1-2H3,(H,26,29)/p+1/t20-/m1/s1 |
| InChIKey | KLVYABKOHZOSPP-HXUWFJFHSA-O |
| XLogP | 2.73 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |