C22H30N3O2+ — CID 8529020
2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(4-methylphenyl)propyl]acetamide (PubChem CID 8529020) has the molecular formula C22H30N3O2+ and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(4-methylphenyl)propyl]acetamide.
| Compound Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(4-methylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 8529020 |
| Molecular Formula | C22H30N3O2+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-(4-methylphenyl)propyl]acetamide |
| SMILES | CC[C@H](NC(=O)C[NH+]1CCN(c2ccccc2O)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-3-19(18-10-8-17(2)9-11-18)23-22(27)16-24-12-14-25(15-13-24)20-6-4-5-7-21(20)26/h4-11,19,26H,3,12-16H2,1-2H3,(H,23,27)/p+1/t19-/m0/s1 |
| InChIKey | YOSVEXOCLHOSCB-IBGZPJMESA-O |
| XLogP | 1.67 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |