C24H34N3O2+ — CID 8703554
2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide (PubChem CID 8703554) has the molecular formula C24H34N3O2+ and a molecular weight of 396.56 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide.
| Compound Name | 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 8703554 |
| Molecular Formula | C24H34N3O2+ |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-(4-methylphenyl)propyl]acetamide |
| SMILES | CCOc1ccccc1N1CC[NH+](CC(=O)N[C@H](CC)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-4-21(20-12-10-19(3)11-13-20)25-24(28)18-26-14-16-27(17-15-26)22-8-6-7-9-23(22)29-5-2/h6-13,21H,4-5,14-18H2,1-3H3,(H,25,28)/p+1/t21-/m1/s1 |
| InChIKey | CLIHARYJFQQHBS-OAQYLSRUSA-O |
| XLogP | 2.37 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |