C23H32N3O2+ — CID 9346067
2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-phenylbutyl]acetamide (PubChem CID 9346067) has the molecular formula C23H32N3O2+ and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-phenylbutyl]acetamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 9346067 |
| Molecular Formula | C23H32N3O2+ |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-N-[(1R)-1-phenylbutyl]acetamide |
| SMILES | CCC[C@@H](NC(=O)C[NH+]1CCN(c2ccccc2OC)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O2/c1-3-9-20(19-10-5-4-6-11-19)24-23(27)18-25-14-16-26(17-15-25)21-12-7-8-13-22(21)28-2/h4-8,10-13,20H,3,9,14-18H2,1-2H3,(H,24,27)/p+1/t20-/m1/s1 |
| InChIKey | GWOCPHQXOUCKLG-HXUWFJFHSA-O |
| XLogP | 2.06 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |