C22H30N3O+ — CID 9345025
N-[(1S)-1-phenylbutyl]-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 9345025) has the molecular formula C22H30N3O+ and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[(1S)-1-phenylbutyl]-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[(1S)-1-phenylbutyl]-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 9345025 |
| Molecular Formula | C22H30N3O+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-[(1S)-1-phenylbutyl]-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | CCC[C@H](NC(=O)C[NH+]1CCN(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O/c1-2-9-21(19-10-5-3-6-11-19)23-22(26)18-24-14-16-25(17-15-24)20-12-7-4-8-13-20/h3-8,10-13,21H,2,9,14-18H2,1H3,(H,23,26)/p+1/t21-/m0/s1 |
| InChIKey | CAPQHDKWCGWGMW-NRFANRHFSA-O |
| XLogP | 2.05 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |