C17H28N3O2+ — CID 8691263
2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(2S)-pentan-2-yl]acetamide (PubChem CID 8691263) has the molecular formula C17H28N3O2+ and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(2S)-pentan-2-yl]acetamide.
| Compound Name | 2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(2S)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 8691263 |
| Molecular Formula | C17H28N3O2+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(2S)-pentan-2-yl]acetamide |
| SMILES | CCC[C@H](C)NC(=O)C[NH+]1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C17H27N3O2/c1-3-4-14(2)18-17(22)13-19-9-11-20(12-10-19)15-5-7-16(21)8-6-15/h5-8,14,21H,3-4,9-13H2,1-2H3,(H,18,22)/p+1/t14-/m0/s1 |
| InChIKey | LXZNVCBGKNZDBZ-AWEZNQCLSA-O |
| XLogP | 0.40 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |