C18H27F3N3O+ — CID 8548238
N-[(2R)-pentan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 8548238) has the molecular formula C18H27F3N3O+ and a molecular weight of 358.43 g/mol. Its IUPAC name is N-[(2R)-pentan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(2R)-pentan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8548238 |
| Molecular Formula | C18H27F3N3O+ |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | N-[(2R)-pentan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CCC[C@@H](C)NC(=O)C[NH+]1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H26F3N3O/c1-3-5-14(2)22-17(25)13-23-8-10-24(11-9-23)16-7-4-6-15(12-16)18(19,20)21/h4,6-7,12,14H,3,5,8-11,13H2,1-2H3,(H,22,25)/p+1/t14-/m1/s1 |
| InChIKey | DJLVFNVWHDFTSF-CQSZACIVSA-O |
| XLogP | 1.72 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |