C17H25F3N3O+ — CID 8548223
N-[(2S)-butan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 8548223) has the molecular formula C17H25F3N3O+ and a molecular weight of 344.40 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8548223 |
| Molecular Formula | C17H25F3N3O+ |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CC[C@H](C)NC(=O)C[NH+]1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H24F3N3O/c1-3-13(2)21-16(24)12-22-7-9-23(10-8-22)15-6-4-5-14(11-15)17(18,19)20/h4-6,11,13H,3,7-10,12H2,1-2H3,(H,21,24)/p+1/t13-/m0/s1 |
| InChIKey | LPTYCDHZJWUKJT-ZDUSSCGKSA-O |
| XLogP | 1.33 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |