C20H29F3N3O+ — CID 8547670
N-(4-methylcyclohexyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 8547670) has the molecular formula C20H29F3N3O+ and a molecular weight of 384.47 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-methylcyclohexyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8547670 |
| Molecular Formula | C20H29F3N3O+ |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N-(4-methylcyclohexyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CC1CCC(NC(=O)C[NH+]2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H28F3N3O/c1-15-5-7-17(8-6-15)24-19(27)14-25-9-11-26(12-10-25)18-4-2-3-16(13-18)20(21,22)23/h2-4,13,15,17H,5-12,14H2,1H3,(H,24,27)/p+1 |
| InChIKey | SNGUADBACLQBIJ-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |