C19H30N3O2+ — CID 8528568
2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide (PubChem CID 8528568) has the molecular formula C19H30N3O2+ and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 8528568 |
| Molecular Formula | C19H30N3O2+ |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)C[NH+]2CCN(c3ccccc3O)CC2)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-15-6-8-16(9-7-15)20-19(24)14-21-10-12-22(13-11-21)17-4-2-3-5-18(17)23/h2-5,15-16,23H,6-14H2,1H3,(H,20,24)/p+1 |
| InChIKey | PRTAIRUHRSONNM-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |