C19H23N4O3+ — CID 2697707
4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide (PubChem CID 2697707) has the molecular formula C19H23N4O3+ and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2697707 |
| Molecular Formula | C19H23N4O3+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C[NH+]2CCN(c3ccccc3O)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O3/c20-19(26)14-5-7-15(8-6-14)21-18(25)13-22-9-11-23(12-10-22)16-3-1-2-4-17(16)24/h1-8,24H,9-13H2,(H2,20,26)(H,21,25)/p+1 |
| InChIKey | ZZWXRDKLQXEBLO-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |