C17H19N4O2S+ — CID 2508369
N-(3-cyanothiophen-2-yl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2508369) has the molecular formula C17H19N4O2S+ and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2508369 |
| Molecular Formula | C17H19N4O2S+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | N#Cc1ccsc1NC(=O)C[NH+]1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C17H18N4O2S/c18-11-13-5-10-24-17(13)19-16(23)12-20-6-8-21(9-7-20)14-3-1-2-4-15(14)22/h1-5,10,22H,6-9,12H2,(H,19,23)/p+1 |
| InChIKey | DINSINZNUWRYTA-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |