C18H24N3O2S+ — CID 9028215
2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 9028215) has the molecular formula C18H24N3O2S+ and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 9028215 |
| Molecular Formula | C18H24N3O2S+ |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2O)CC1)NCCc1cccs1 |
| InChI | InChI=1S/C18H23N3O2S/c22-17-6-2-1-5-16(17)21-11-9-20(10-12-21)14-18(23)19-8-7-15-4-3-13-24-15/h1-6,13,22H,7-12,14H2,(H,19,23)/p+1 |
| InChIKey | LIAKRMWZNHYZJC-UHFFFAOYSA-O |
| XLogP | 0.52 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |