C14H22N3O2S+ — CID 8557188
1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8557188) has the molecular formula C14H22N3O2S+ and a molecular weight of 296.42 g/mol. Its IUPAC name is 1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8557188 |
| Molecular Formula | C14H22N3O2S+ |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](CC(=O)NCCc2cccs2)CC1 |
| InChI | InChI=1S/C14H21N3O2S/c15-14(19)11-4-7-17(8-5-11)10-13(18)16-6-3-12-2-1-9-20-12/h1-2,9,11H,3-8,10H2,(H2,15,19)(H,16,18)/p+1 |
| InChIKey | CRXAMRZTTMTIMP-UHFFFAOYSA-O |
| XLogP | -0.81 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |