C18H23ClN3OS+ — CID 9028497
2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 9028497) has the molecular formula C18H23ClN3OS+ and a molecular weight of 364.92 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 9028497 |
| Molecular Formula | C18H23ClN3OS+ |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2Cl)CC1)NCCc1cccs1 |
| InChI | InChI=1S/C18H22ClN3OS/c19-16-5-1-2-6-17(16)22-11-9-21(10-12-22)14-18(23)20-8-7-15-4-3-13-24-15/h1-6,13H,7-12,14H2,(H,20,23)/p+1 |
| InChIKey | UXKLIMCIIOLLPL-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |