C21H27ClN3OS+ — CID 9028533
2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 9028533) has the molecular formula C21H27ClN3OS+ and a molecular weight of 404.99 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 9028533 |
| Molecular Formula | C21H27ClN3OS+ |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)C[NH+]2CCN(c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H26ClN3OS/c1-17-6-8-18(9-7-17)27-15-10-23-21(26)16-24-11-13-25(14-12-24)20-5-3-2-4-19(20)22/h2-9H,10-16H2,1H3,(H,23,26)/p+1 |
| InChIKey | LEMXAOUPKORIPD-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|