C19H29ClN3O+ — CID 8704491
2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide (PubChem CID 8704491) has the molecular formula C19H29ClN3O+ and a molecular weight of 350.91 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 8704491 |
| Molecular Formula | C19H29ClN3O+ |
| Molecular Weight | 350.91 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)C[NH+]2CCN(c3ccccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C19H28ClN3O/c1-15-6-8-16(9-7-15)21-19(24)14-22-10-12-23(13-11-22)18-5-3-2-4-17(18)20/h2-5,15-16H,6-14H2,1H3,(H,21,24)/p+1 |
| InChIKey | AQNWGRGHZYZQDY-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.91 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |