C18H26ClN4O2+ — CID 2573315
2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(cyclopentylcarbamoyl)acetamide (PubChem CID 2573315) has the molecular formula C18H26ClN4O2+ and a molecular weight of 365.89 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(cyclopentylcarbamoyl)acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(cyclopentylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2573315 |
| Molecular Formula | C18H26ClN4O2+ |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-(cyclopentylcarbamoyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2Cl)CC1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H25ClN4O2/c19-15-7-3-4-8-16(15)23-11-9-22(10-12-23)13-17(24)21-18(25)20-14-5-1-2-6-14/h3-4,7-8,14H,1-2,5-6,9-13H2,(H2,20,21,24,25)/p+1 |
| InChIKey | LHVQXWANOWNKPZ-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |