C20H31N4O3+ — CID 2655453
N-(cyclohexylcarbamoyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2655453) has the molecular formula C20H31N4O3+ and a molecular weight of 375.49 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(cyclohexylcarbamoyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2655453 |
| Molecular Formula | C20H31N4O3+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)NC(=O)NC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H30N4O3/c1-27-18-9-7-17(8-10-18)24-13-11-23(12-14-24)15-19(25)22-20(26)21-16-5-3-2-4-6-16/h7-10,16H,2-6,11-15H2,1H3,(H2,21,22,25,26)/p+1 |
| InChIKey | IUZOABMGWDRFKX-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|