C17H25ClN3O4S+ — CID 8587403
N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8587403) has the molecular formula C17H25ClN3O4S+ and a molecular weight of 402.92 g/mol. Its IUPAC name is N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8587403 |
| Molecular Formula | C17H25ClN3O4S+ |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)N[C@H]3CS(=O)(=O)C[C@@H]3Cl)CC2)cc1 |
| InChI | InChI=1S/C17H24ClN3O4S/c1-25-14-4-2-13(3-5-14)21-8-6-20(7-9-21)10-17(22)19-16-12-26(23,24)11-15(16)18/h2-5,15-16H,6-12H2,1H3,(H,19,22)/p+1/t15-,16-/m0/s1 |
| InChIKey | LYSSADLBNLNSIO-HOTGVXAUSA-O |
| XLogP | -1.08 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|