C14H18ClNO4S — CID 78910672
N-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)propanamide (PubChem CID 78910672) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 78910672 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NC2CS(=O)(=O)CC2Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO4S/c1-20-11-5-2-10(3-6-11)4-7-14(17)16-13-9-21(18,19)8-12(13)15/h2-3,5-6,12-13H,4,7-9H2,1H3,(H,16,17) |
| InChIKey | MXBWZZJQJGJHDG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|