C13H16ClNO4S — CID 41111404
N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-methoxyphenyl)acetamide (PubChem CID 41111404) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 41111404 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N[C@@H]2CS(=O)(=O)C[C@@H]2Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO4S/c1-19-10-4-2-9(3-5-10)6-13(16)15-12-8-20(17,18)7-11(12)14/h2-5,11-12H,6-8H2,1H3,(H,15,16)/t11-,12+/m0/s1 |
| InChIKey | IINQXUVPXBGMAU-NWDGAFQWSA-N |
| XLogP | 0.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|