C7H12ClNO3S — CID 41009565
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 41009565) has the molecular formula C7H12ClNO3S and a molecular weight of 225.70 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 41009565 |
| Molecular Formula | C7H12ClNO3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C7H12ClNO3S/c1-2-7(10)9-6-4-13(11,12)3-5(6)8/h5-6H,2-4H2,1H3,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | SEZGBYLTSMNHRC-RITPCOANSA-N |
| XLogP | -0.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|