C10H18N2O5S — CID 100825852
ethyl N-[(3R,4R)-1,1-dioxo-4-(propanoylamino)thiolan-3-yl]carbamate (PubChem CID 100825852) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is ethyl N-[(3R,4R)-1,1-dioxo-4-(propanoylamino)thiolan-3-yl]carbamate.
| Compound Name | ethyl N-[(3R,4R)-1,1-dioxo-4-(propanoylamino)thiolan-3-yl]carbamate |
|---|---|
| PubChem CID | 100825852 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | ethyl N-[(3R,4R)-1,1-dioxo-4-(propanoylamino)thiolan-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@H]1CS(=O)(=O)C[C@@H]1NC(=O)CC |
| InChI | InChI=1S/C10H18N2O5S/c1-3-9(13)11-7-5-18(15,16)6-8(7)12-10(14)17-4-2/h7-8H,3-6H2,1-2H3,(H,11,13)(H,12,14)/t7-,8-/m0/s1 |
| InChIKey | OPRRKWOVLRKYCU-YUMQZZPRSA-N |
| XLogP | -0.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |