C8H13NO4S — CID 18653264
(3S,4R)-4-(ethoxycarbonylamino)thiolane-3-carboxylic acid (PubChem CID 18653264) has the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. Its IUPAC name is (3S,4R)-4-(ethoxycarbonylamino)thiolane-3-carboxylic acid.
| Compound Name | (3S,4R)-4-(ethoxycarbonylamino)thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 18653264 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (3S,4R)-4-(ethoxycarbonylamino)thiolane-3-carboxylic acid |
| SMILES | CCOC(=O)N[C@H]1CSC[C@@H]1C(=O)O |
| InChI | InChI=1S/C8H13NO4S/c1-2-13-8(12)9-6-4-14-3-5(6)7(10)11/h5-6H,2-4H2,1H3,(H,9,12)(H,10,11)/t5-,6-/m0/s1 |
| InChIKey | HJSIZIIEKUDZOA-WDSKDSINSA-N |
| XLogP | 0.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |