About ethyl N-(thian-4-yl)carbamate
ethyl N-(thian-4-yl)carbamate (PubChem CID 115599837) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is ethyl N-(thian-4-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(thian-4-yl)carbamate |
| PubChem CID | 115599837 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | ethyl N-(thian-4-yl)carbamate |
| SMILES | CCOC(=O)NC1CCSCC1 |
| InChI | InChI=1S/C8H15NO2S/c1-2-11-8(10)9-7-3-5-12-6-4-7/h7H,2-6H2,1H3,(H,9,10) |
| InChIKey | FGACITIYIAFZEX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-(thian-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(thian-4-yl)carbamate?
The IUPAC name of ethyl N-(thian-4-yl)carbamate (CID 115599837) is ethyl N-(thian-4-yl)carbamate.
What is the SMILES notation for ethyl N-(thian-4-yl)carbamate?
The canonical SMILES for ethyl N-(thian-4-yl)carbamate is CCOC(=O)NC1CCSCC1.
What is the InChIKey of ethyl N-(thian-4-yl)carbamate?
The InChIKey is FGACITIYIAFZEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-2-11-8(10)9-7-3-5-12-6-4-7/h7H,2-6H2,1H3,(H,9,10).
What are the key properties of ethyl N-(thian-4-yl)carbamate?
ethyl N-(thian-4-yl)carbamate has a molecular weight of 189.28 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(thian-4-yl)carbamate is sourced from PubChem (CID 115599837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).