C14H20N2O3S — CID 133269437
N-[(3S,4S)-4-(benzylamino)-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 133269437) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[(3S,4S)-4-(benzylamino)-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | N-[(3S,4S)-4-(benzylamino)-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 133269437 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[(3S,4S)-4-(benzylamino)-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | CCC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-2-14(17)16-13-10-20(18,19)9-12(13)15-8-11-6-4-3-5-7-11/h3-7,12-13,15H,2,8-10H2,1H3,(H,16,17)/t12-,13-/m1/s1 |
| InChIKey | PASSKMUAOIHFFK-CHWSQXEVSA-N |
| XLogP | 0.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |