C11H15NO4S — CID 114331750
4-[(4-hydroxyphenyl)methylamino]-1,1-dioxothiolan-3-ol (PubChem CID 114331750) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)methylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[(4-hydroxyphenyl)methylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 114331750 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-[(4-hydroxyphenyl)methylamino]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C11H15NO4S/c13-9-3-1-8(2-4-9)5-12-10-6-17(15,16)7-11(10)14/h1-4,10-14H,5-7H2 |
| InChIKey | RIBLBDMRTZRTHJ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |