C13H19NO5S — CID 60665905
4-[(3,4-dimethoxyphenyl)methylamino]-1,1-dioxothiolan-3-ol (PubChem CID 60665905) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60665905 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methylamino]-1,1-dioxothiolan-3-ol |
| SMILES | COc1ccc(CNC2CS(=O)(=O)CC2O)cc1OC |
| InChI | InChI=1S/C13H19NO5S/c1-18-12-4-3-9(5-13(12)19-2)6-14-10-7-20(16,17)8-11(10)15/h3-5,10-11,14-15H,6-8H2,1-2H3 |
| InChIKey | IRFFQSAMAORKOT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |