About (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol
(3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol (PubChem CID 51890027) has the molecular formula C11H14FNO3S
and a molecular weight of 259.30 g/mol. Its IUPAC name is (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 51890027 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@H](NCc2cccc(F)c2)[C@@H](O)C1 |
| InChI | InChI=1S/C11H14FNO3S/c12-9-3-1-2-8(4-9)5-13-10-6-17(15,16)7-11(10)14/h1-4,10-11,13-14H,5-7H2/t10-,11-/m0/s1 |
| InChIKey | VXFKOMXQJQZCMW-QWRGUYRKSA-N |
| XLogP | 0.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol?
The IUPAC name of (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol (CID 51890027) is (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol is O=S1(=O)C[C@H](NCc2cccc(F)c2)[C@@H](O)C1.
What is the InChIKey of (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol?
The InChIKey is VXFKOMXQJQZCMW-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H14FNO3S/c12-9-3-1-2-8(4-9)5-13-10-6-17(15,16)7-11(10)14/h1-4,10-11,13-14H,5-7H2/t10-,11-/m0/s1.
What are the key properties of (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol?
(3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol has a molecular weight of 259.30 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 51890027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).