C11H14FNO3S — CID 51890027
(3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol (PubChem CID 51890027) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 51890027 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (3R,4R)-4-[(3-fluorophenyl)methylamino]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@H](NCc2cccc(F)c2)[C@@H](O)C1 |
| InChI | InChI=1S/C11H14FNO3S/c12-9-3-1-2-8(4-9)5-13-10-6-17(15,16)7-11(10)14/h1-4,10-11,13-14H,5-7H2/t10-,11-/m0/s1 |
| InChIKey | VXFKOMXQJQZCMW-QWRGUYRKSA-N |
| XLogP | 0.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |