C18H21NO4S2 — CID 124644055
(3R,4S)-N-benzyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 124644055) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (3R,4S)-N-benzyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3R,4S)-N-benzyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 124644055 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (3R,4S)-N-benzyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2CS(=O)(=O)C[C@H]2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO4S2/c1-14-7-9-16(10-8-14)25(22,23)18-13-24(20,21)12-17(18)19-11-15-5-3-2-4-6-15/h2-10,17-19H,11-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | WWSFMVQRLMAHGF-QZTJIDSGSA-N |
| XLogP | 1.72 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |