C14H21NO4S2 — CID 20897793
(3S,4R)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine (PubChem CID 20897793) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3S,4R)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine |
|---|---|
| PubChem CID | 20897793 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (3S,4R)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine |
| SMILES | CCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21NO4S2/c1-3-8-15-13-9-20(16,17)10-14(13)21(18,19)12-6-4-11(2)5-7-12/h4-7,13-15H,3,8-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | JMICWGRQLBFKCD-KBPBESRZSA-N |
| XLogP | 0.93 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |