C17H27NO5S2 — CID 124655048
(3R,4S)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine (PubChem CID 124655048) has the molecular formula C17H27NO5S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (3R,4S)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine.
| Compound Name | (3R,4S)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine |
|---|---|
| PubChem CID | 124655048 |
| Molecular Formula | C17H27NO5S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (3R,4S)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2CS(=O)(=O)C[C@H]2NCCCOC(C)C)cc1 |
| InChI | InChI=1S/C17H27NO5S2/c1-13(2)23-10-4-9-18-16-11-24(19,20)12-17(16)25(21,22)15-7-5-14(3)6-8-15/h5-8,13,16-18H,4,9-12H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | DXHFWRGYMDZIGA-IAGOWNOFSA-N |
| XLogP | 1.34 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|