C17H26N2O6S2 — CID 21006327
N-[4-[(3R,4S)-4-(3-ethoxypropylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide (PubChem CID 21006327) has the molecular formula C17H26N2O6S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[4-[(3R,4S)-4-(3-ethoxypropylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[(3R,4S)-4-(3-ethoxypropylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 21006327 |
| Molecular Formula | C17H26N2O6S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[4-[(3R,4S)-4-(3-ethoxypropylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide |
| SMILES | CCOCCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H26N2O6S2/c1-3-25-10-4-9-18-16-11-26(21,22)12-17(16)27(23,24)15-7-5-14(6-8-15)19-13(2)20/h5-8,16-18H,3-4,9-12H2,1-2H3,(H,19,20)/t16-,17-/m0/s1 |
| InChIKey | UXROLTPFTYWKGM-IRXDYDNUSA-N |
| XLogP | 0.60 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|