C21H27NO6S2 — CID 45370334
4-(4-ethylphenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 45370334) has the molecular formula C21H27NO6S2 and a molecular weight of 453.58 g/mol. Its IUPAC name is 4-(4-ethylphenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | 4-(4-ethylphenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 45370334 |
| Molecular Formula | C21H27NO6S2 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 4-(4-ethylphenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCc1ccc(S(=O)(=O)C2CS(=O)(=O)CC2NCCOc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H27NO6S2/c1-3-16-4-10-19(11-5-16)30(25,26)21-15-29(23,24)14-20(21)22-12-13-28-18-8-6-17(27-2)7-9-18/h4-11,20-22H,3,12-15H2,1-2H3 |
| InChIKey | WTZPSAGNIIOTCR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|