C15H23NO5S2 — CID 22695486
4-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine (PubChem CID 22695486) has the molecular formula C15H23NO5S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine.
| Compound Name | 4-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 22695486 |
| Molecular Formula | C15H23NO5S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-(4-ethylphenyl)sulfonyl-N-(2-methoxyethyl)-1,1-dioxothiolan-3-amine |
| SMILES | CCc1ccc(S(=O)(=O)C2CS(=O)(=O)CC2NCCOC)cc1 |
| InChI | InChI=1S/C15H23NO5S2/c1-3-12-4-6-13(7-5-12)23(19,20)15-11-22(17,18)10-14(15)16-8-9-21-2/h4-7,14-16H,3,8-11H2,1-2H3 |
| InChIKey | NVNNNSJXYGFCKZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|