C15H22N2O6S2 — CID 124655786
N-[4-[(3S,4R)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide (PubChem CID 124655786) has the molecular formula C15H22N2O6S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[4-[(3S,4R)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[(3S,4R)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 124655786 |
| Molecular Formula | C15H22N2O6S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[4-[(3S,4R)-4-(2-methoxyethylamino)-1,1-dioxothiolan-3-yl]sulfonylphenyl]acetamide |
| SMILES | COCCN[C@@H]1CS(=O)(=O)C[C@H]1S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C15H22N2O6S2/c1-11(18)17-12-3-5-13(6-4-12)25(21,22)15-10-24(19,20)9-14(15)16-7-8-23-2/h3-6,14-16H,7-10H2,1-2H3,(H,17,18)/t14-,15-/m1/s1 |
| InChIKey | AXHMZQFJHDAMAM-HUUCEWRRSA-N |
| XLogP | -0.18 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|