C16H24ClNO5S2 — CID 124655638
(3R,4S)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine (PubChem CID 124655638) has the molecular formula C16H24ClNO5S2 and a molecular weight of 409.96 g/mol. Its IUPAC name is (3R,4S)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine.
| Compound Name | (3R,4S)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine |
|---|---|
| PubChem CID | 124655638 |
| Molecular Formula | C16H24ClNO5S2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (3R,4S)-4-(4-chlorophenyl)sulfonyl-1,1-dioxo-N-(3-propan-2-yloxypropyl)thiolan-3-amine |
| SMILES | CC(C)OCCCN[C@@H]1CS(=O)(=O)C[C@H]1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNO5S2/c1-12(2)23-9-3-8-18-15-10-24(19,20)11-16(15)25(21,22)14-6-4-13(17)5-7-14/h4-7,12,15-16,18H,3,8-11H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | PSYQMTZRZDQGIF-HZPDHXFCSA-N |
| XLogP | 1.68 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|