C17H27NO6S2 — CID 39775364
(3S,4R)-N-(3-ethoxypropyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 39775364) has the molecular formula C17H27NO6S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (3S,4R)-N-(3-ethoxypropyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-N-(3-ethoxypropyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 39775364 |
| Molecular Formula | C17H27NO6S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (3S,4R)-N-(3-ethoxypropyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | CCOCCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C17H27NO6S2/c1-4-24-9-5-8-18-15-11-25(19,20)12-17(15)26(21,22)14-6-7-16(23-3)13(2)10-14/h6-7,10,15,17-18H,4-5,8-9,11-12H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | LGIKDKHZPQJJKW-RDJZCZTQSA-N |
| XLogP | 0.96 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|