C16H24FNO4S2 — CID 20898018
(3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-1,1-dioxo-N-pentylthiolan-3-amine (PubChem CID 20898018) has the molecular formula C16H24FNO4S2 and a molecular weight of 377.50 g/mol. Its IUPAC name is (3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-1,1-dioxo-N-pentylthiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-1,1-dioxo-N-pentylthiolan-3-amine |
|---|---|
| PubChem CID | 20898018 |
| Molecular Formula | C16H24FNO4S2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (3S,4R)-4-(4-fluoro-3-methylphenyl)sulfonyl-1,1-dioxo-N-pentylthiolan-3-amine |
| SMILES | CCCCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C16H24FNO4S2/c1-3-4-5-8-18-15-10-23(19,20)11-16(15)24(21,22)13-6-7-14(17)12(2)9-13/h6-7,9,15-16,18H,3-5,8,10-11H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | YJGRVXNUPFLNSV-HOTGVXAUSA-N |
| XLogP | 1.85 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|