C13H21NO4S3 — CID 124647869
(3R,4S)-1,1-dioxo-N-pentyl-4-thiophen-2-ylsulfonylthiolan-3-amine (PubChem CID 124647869) has the molecular formula C13H21NO4S3 and a molecular weight of 351.52 g/mol. Its IUPAC name is (3R,4S)-1,1-dioxo-N-pentyl-4-thiophen-2-ylsulfonylthiolan-3-amine.
| Compound Name | (3R,4S)-1,1-dioxo-N-pentyl-4-thiophen-2-ylsulfonylthiolan-3-amine |
|---|---|
| PubChem CID | 124647869 |
| Molecular Formula | C13H21NO4S3 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (3R,4S)-1,1-dioxo-N-pentyl-4-thiophen-2-ylsulfonylthiolan-3-amine |
| SMILES | CCCCCN[C@@H]1CS(=O)(=O)C[C@H]1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H21NO4S3/c1-2-3-4-7-14-11-9-20(15,16)10-12(11)21(17,18)13-6-5-8-19-13/h5-6,8,11-12,14H,2-4,7,9-10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | ZKBGNSOCSWXNNF-VXGBXAGGSA-N |
| XLogP | 1.47 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|