C20H29NO5S2 — CID 42346261
(3R,4S)-N-[2-(cyclohexen-1-yl)ethyl]-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 42346261) has the molecular formula C20H29NO5S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is (3R,4S)-N-[2-(cyclohexen-1-yl)ethyl]-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3R,4S)-N-[2-(cyclohexen-1-yl)ethyl]-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 42346261 |
| Molecular Formula | C20H29NO5S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (3R,4S)-N-[2-(cyclohexen-1-yl)ethyl]-4-(4-methoxy-3-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | COc1ccc(S(=O)(=O)[C@@H]2CS(=O)(=O)C[C@H]2NCCC2=CCCCC2)cc1C |
| InChI | InChI=1S/C20H29NO5S2/c1-15-12-17(8-9-19(15)26-2)28(24,25)20-14-27(22,23)13-18(20)21-11-10-16-6-4-3-5-7-16/h6,8-9,12,18,20-21H,3-5,7,10-11,13-14H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | OSODTAPHAZEJCF-UYAOXDASSA-N |
| XLogP | 2.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|