C16H22ClNO4S3 — CID 21006608
(3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 21006608) has the molecular formula C16H22ClNO4S3 and a molecular weight of 424.01 g/mol. Its IUPAC name is (3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 21006608 |
| Molecular Formula | C16H22ClNO4S3 |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | (3S,4R)-4-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)C[C@H](NCCC2=CCCCC2)[C@@H](S(=O)(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C16H22ClNO4S3/c17-15-6-7-16(23-15)25(21,22)14-11-24(19,20)10-13(14)18-9-8-12-4-2-1-3-5-12/h4,6-7,13-14,18H,1-3,5,8-11H2/t13-,14-/m0/s1 |
| InChIKey | FLVNTTXYJKUFOK-KBPBESRZSA-N |
| XLogP | 2.82 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|