C18H25NO4S2 — CID 20897734
(3S,4R)-4-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 20897734) has the molecular formula C18H25NO4S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (3S,4R)-4-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-4-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 20897734 |
| Molecular Formula | C18H25NO4S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (3S,4R)-4-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)C[C@H](NCCC2=CCCCC2)[C@@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H25NO4S2/c20-24(21)13-17(19-12-11-15-7-3-1-4-8-15)18(14-24)25(22,23)16-9-5-2-6-10-16/h2,5-7,9-10,17-19H,1,3-4,8,11-14H2/t17-,18-/m0/s1 |
| InChIKey | MMQKJKFXPQBSLP-ROUUACIJSA-N |
| XLogP | 2.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|