C20H29ClN2O3S2 — CID 95088891
(2R)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 95088891) has the molecular formula C20H29ClN2O3S2 and a molecular weight of 445.05 g/mol. Its IUPAC name is (2R)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | (2R)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 95088891 |
| Molecular Formula | C20H29ClN2O3S2 |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (2R)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | C[C@@H](C(=O)NCCC1=CCCCC1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C20H29ClN2O3S2/c1-15(20(24)22-12-9-16-5-3-2-4-6-16)17-10-13-23(14-11-17)28(25,26)19-8-7-18(21)27-19/h5,7-8,15,17H,2-4,6,9-14H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | FNXSZEOIQZXDFU-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|