C13H19ClN2O3S2 — CID 113002500
1-(5-chlorothiophen-2-yl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 113002500) has the molecular formula C13H19ClN2O3S2 and a molecular weight of 350.89 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 113002500 |
| Molecular Formula | C13H19ClN2O3S2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)NC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H19ClN2O3S2/c1-9(2)15-13(17)10-5-7-16(8-6-10)21(18,19)12-4-3-11(14)20-12/h3-4,9-10H,5-8H2,1-2H3,(H,15,17) |
| InChIKey | JYIIGZZYJMQPJY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |